C9H15NO6 — CID 141386439
1-(1,1-dihydroxypropoxycarbonylamino)ethyl prop-2-enoate (PubChem CID 141386439) has the molecular formula C9H15NO6 and a molecular weight of 233.22 g/mol. Its IUPAC name is 1-(1,1-dihydroxypropoxycarbonylamino)ethyl prop-2-enoate.
| Compound Name | 1-(1,1-dihydroxypropoxycarbonylamino)ethyl prop-2-enoate |
|---|---|
| PubChem CID | 141386439 |
| Molecular Formula | C9H15NO6 |
| Molecular Weight | 233.22 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | 1-(1,1-dihydroxypropoxycarbonylamino)ethyl prop-2-enoate |
| SMILES | C=CC(=O)OC(C)NC(=O)OC(O)(O)CC |
| InChI | InChI=1S/C9H15NO6/c1-4-7(11)15-6(3)10-8(12)16-9(13,14)5-2/h4,6,13-14H,1,5H2,2-3H3,(H,10,12) |
| InChIKey | SLNHGOXDGVERDO-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.22 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|