C12H20N2O5 — CID 88701752
1-hydroxyethyl prop-2-enoate;2-methylprop-2-enamide;prop-2-enamide (PubChem CID 88701752) has the molecular formula C12H20N2O5 and a molecular weight of 272.30 g/mol. Its IUPAC name is 1-hydroxyethyl prop-2-enoate;2-methylprop-2-enamide;prop-2-enamide.
| Compound Name | 1-hydroxyethyl prop-2-enoate;2-methylprop-2-enamide;prop-2-enamide |
|---|---|
| PubChem CID | 88701752 |
| Molecular Formula | C12H20N2O5 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | 1-hydroxyethyl prop-2-enoate;2-methylprop-2-enamide;prop-2-enamide |
| SMILES | C=C(C)C(N)=O.C=CC(=O)OC(C)O.C=CC(N)=O |
| InChI | InChI=1S/C5H8O3.C4H7NO.C3H5NO/c1-3-5(7)8-4(2)6;1-3(2)4(5)6;1-2-3(4)5/h3-4,6H,1H2,2H3;1H2,2H3,(H2,5,6);2H,1H2,(H2,4,5) |
| InChIKey | QXZQDDRLMVHMKS-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 132.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|