About 1-hydroxyethyl prop-2-enoate;N-(3-hydroxyprop-1-en-2-yl)formamide
1-hydroxyethyl prop-2-enoate;N-(3-hydroxyprop-1-en-2-yl)formamide (PubChem CID 174878591) has the molecular formula C9H15NO5
and a molecular weight of 217.22 g/mol. Its IUPAC name is 1-hydroxyethyl prop-2-enoate;N-(3-hydroxyprop-1-en-2-yl)formamide.
Molecular Properties
| Compound Name | 1-hydroxyethyl prop-2-enoate;N-(3-hydroxyprop-1-en-2-yl)formamide |
| PubChem CID | 174878591 |
| Molecular Formula | C9H15NO5 |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.10 |
| IUPAC Name | 1-hydroxyethyl prop-2-enoate;N-(3-hydroxyprop-1-en-2-yl)formamide |
| SMILES | C=C(CO)NC=O.C=CC(=O)OC(C)O |
| InChI | InChI=1S/C5H8O3.C4H7NO2/c1-3-5(7)8-4(2)6;1-4(2-6)5-3-7/h3-4,6H,1H2,2H3;3,6H,1-2H2,(H,5,7) |
| InChIKey | QJMHYTALPKBYJO-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-hydroxyethyl prop-2-enoate;N-(3-hydroxyprop-1-en-2-yl)formamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxyethyl prop-2-enoate;N-(3-hydroxyprop-1-en-2-yl)formamide?
The IUPAC name of 1-hydroxyethyl prop-2-enoate;N-(3-hydroxyprop-1-en-2-yl)formamide (CID 174878591) is 1-hydroxyethyl prop-2-enoate;N-(3-hydroxyprop-1-en-2-yl)formamide.
What is the SMILES notation for 1-hydroxyethyl prop-2-enoate;N-(3-hydroxyprop-1-en-2-yl)formamide?
The canonical SMILES for 1-hydroxyethyl prop-2-enoate;N-(3-hydroxyprop-1-en-2-yl)formamide is C=C(CO)NC=O.C=CC(=O)OC(C)O.
What is the InChIKey of 1-hydroxyethyl prop-2-enoate;N-(3-hydroxyprop-1-en-2-yl)formamide?
The InChIKey is QJMHYTALPKBYJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O3.C4H7NO2/c1-3-5(7)8-4(2)6;1-4(2-6)5-3-7/h3-4,6H,1H2,2H3;3,6H,1-2H2,(H,5,7).
What are the key properties of 1-hydroxyethyl prop-2-enoate;N-(3-hydroxyprop-1-en-2-yl)formamide?
1-hydroxyethyl prop-2-enoate;N-(3-hydroxyprop-1-en-2-yl)formamide has a molecular weight of 217.22 g/mol, XLogP of -0.71, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxyethyl prop-2-enoate;N-(3-hydroxyprop-1-en-2-yl)formamide is sourced from PubChem (CID 174878591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).