C9H16O7 — CID 174945247
3,3-dihydroxy-2-methylpropanoic acid;1-hydroxyethyl prop-2-enoate (PubChem CID 174945247) has the molecular formula C9H16O7 and a molecular weight of 236.22 g/mol. Its IUPAC name is 3,3-dihydroxy-2-methylpropanoic acid;1-hydroxyethyl prop-2-enoate.
| Compound Name | 3,3-dihydroxy-2-methylpropanoic acid;1-hydroxyethyl prop-2-enoate |
|---|---|
| PubChem CID | 174945247 |
| Molecular Formula | C9H16O7 |
| Molecular Weight | 236.22 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | 3,3-dihydroxy-2-methylpropanoic acid;1-hydroxyethyl prop-2-enoate |
| SMILES | C=CC(=O)OC(C)O.CC(C(=O)O)C(O)O |
| InChI | InChI=1S/C5H8O3.C4H8O4/c1-3-5(7)8-4(2)6;1-2(3(5)6)4(7)8/h3-4,6H,1H2,2H3;2-3,5-6H,1H3,(H,7,8) |
| InChIKey | ARWWTMKMMXGNFD-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.22 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|