About 5-hydrazinylpentan-2-yl prop-2-enoate
5-hydrazinylpentan-2-yl prop-2-enoate (PubChem CID 139644736) has the molecular formula C8H16N2O2
and a molecular weight of 172.23 g/mol. Its IUPAC name is 5-hydrazinylpentan-2-yl prop-2-enoate.
Molecular Properties
| Compound Name | 5-hydrazinylpentan-2-yl prop-2-enoate |
| PubChem CID | 139644736 |
| Molecular Formula | C8H16N2O2 |
| Molecular Weight | 172.23 g/mol |
| Exact Mass | 172.12 |
| IUPAC Name | 5-hydrazinylpentan-2-yl prop-2-enoate |
| SMILES | C=CC(=O)OC(C)CCCNN |
| InChI | InChI=1S/C8H16N2O2/c1-3-8(11)12-7(2)5-4-6-10-9/h3,7,10H,1,4-6,9H2,2H3 |
| InChIKey | HVUCDMTUTSZCPT-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.23 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-hydrazinylpentan-2-yl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydrazinylpentan-2-yl prop-2-enoate?
The IUPAC name of 5-hydrazinylpentan-2-yl prop-2-enoate (CID 139644736) is 5-hydrazinylpentan-2-yl prop-2-enoate.
What is the SMILES notation for 5-hydrazinylpentan-2-yl prop-2-enoate?
The canonical SMILES for 5-hydrazinylpentan-2-yl prop-2-enoate is C=CC(=O)OC(C)CCCNN.
What is the InChIKey of 5-hydrazinylpentan-2-yl prop-2-enoate?
The InChIKey is HVUCDMTUTSZCPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O2/c1-3-8(11)12-7(2)5-4-6-10-9/h3,7,10H,1,4-6,9H2,2H3.
What are the key properties of 5-hydrazinylpentan-2-yl prop-2-enoate?
5-hydrazinylpentan-2-yl prop-2-enoate has a molecular weight of 172.23 g/mol, XLogP of 0.35, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydrazinylpentan-2-yl prop-2-enoate is sourced from PubChem (CID 139644736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).