C20H34O6 — CID 141499372
12-oxo-12-(4-prop-2-enoyloxypentoxy)dodecanoic acid (PubChem CID 141499372) has the molecular formula C20H34O6 and a molecular weight of 370.49 g/mol. Its IUPAC name is 12-oxo-12-(4-prop-2-enoyloxypentoxy)dodecanoic acid.
| Compound Name | 12-oxo-12-(4-prop-2-enoyloxypentoxy)dodecanoic acid |
|---|---|
| PubChem CID | 141499372 |
| Molecular Formula | C20H34O6 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | 12-oxo-12-(4-prop-2-enoyloxypentoxy)dodecanoic acid |
| SMILES | C=CC(=O)OC(C)CCCOC(=O)CCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C20H34O6/c1-3-19(23)26-17(2)13-12-16-25-20(24)15-11-9-7-5-4-6-8-10-14-18(21)22/h3,17H,1,4-16H2,2H3,(H,21,22) |
| InChIKey | QWTDSUQPHXEURZ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|