C12H21O7P — CID 141274929
[3-oxo-3-(5-prop-2-enoyloxyhexoxy)propyl]phosphonic acid (PubChem CID 141274929) has the molecular formula C12H21O7P and a molecular weight of 308.27 g/mol. Its IUPAC name is [3-oxo-3-(5-prop-2-enoyloxyhexoxy)propyl]phosphonic acid.
| Compound Name | [3-oxo-3-(5-prop-2-enoyloxyhexoxy)propyl]phosphonic acid |
|---|---|
| PubChem CID | 141274929 |
| Molecular Formula | C12H21O7P |
| Molecular Weight | 308.27 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | [3-oxo-3-(5-prop-2-enoyloxyhexoxy)propyl]phosphonic acid |
| SMILES | C=CC(=O)OC(C)CCCCOC(=O)CCP(=O)(O)O |
| InChI | InChI=1S/C12H21O7P/c1-3-11(13)19-10(2)6-4-5-8-18-12(14)7-9-20(15,16)17/h3,10H,1,4-9H2,2H3,(H2,15,16,17) |
| InChIKey | GWHKBHYSCQYZPJ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.27 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|