C10H13NNiO3 — CID 156733186
[(2Z)-2-[[(2S)-1-methoxy-1-oxopropan-2-yl]carbamoyl]penta-2,4-dienylidene]nickel (PubChem CID 156733186) has the molecular formula C10H13NNiO3 and a molecular weight of 253.91 g/mol. Its IUPAC name is [(2Z)-2-[[(2S)-1-methoxy-1-oxopropan-2-yl]carbamoyl]penta-2,4-dienylidene]nickel.
| Compound Name | [(2Z)-2-[[(2S)-1-methoxy-1-oxopropan-2-yl]carbamoyl]penta-2,4-dienylidene]nickel |
|---|---|
| PubChem CID | 156733186 |
| Molecular Formula | C10H13NNiO3 |
| Molecular Weight | 253.91 g/mol |
| Exact Mass | 253.02 |
| IUPAC Name | [(2Z)-2-[[(2S)-1-methoxy-1-oxopropan-2-yl]carbamoyl]penta-2,4-dienylidene]nickel |
| SMILES | C=C/C=C(\C=[Ni])C(=O)N[C@@H](C)C(=O)OC |
| InChI | InChI=1S/C10H13NO3.Ni/c1-5-6-7(2)9(12)11-8(3)10(13)14-4;/h2,5-6,8H,1H2,3-4H3,(H,11,12);/b7-6+;/t8-;/m0./s1 |
| InChIKey | HWMYBJIPXJUJBQ-YITVVEPZSA-N |
| XLogP | 0.13 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.91 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|