C10H16N2O5 — CID 164673637
methyl (2S)-2-[[2-(prop-2-enoxycarbonylamino)acetyl]amino]propanoate (PubChem CID 164673637) has the molecular formula C10H16N2O5 and a molecular weight of 244.25 g/mol. Its IUPAC name is methyl (2S)-2-[[2-(prop-2-enoxycarbonylamino)acetyl]amino]propanoate.
| Compound Name | methyl (2S)-2-[[2-(prop-2-enoxycarbonylamino)acetyl]amino]propanoate |
|---|---|
| PubChem CID | 164673637 |
| Molecular Formula | C10H16N2O5 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | methyl (2S)-2-[[2-(prop-2-enoxycarbonylamino)acetyl]amino]propanoate |
| SMILES | C=CCOC(=O)NCC(=O)N[C@@H](C)C(=O)OC |
| InChI | InChI=1S/C10H16N2O5/c1-4-5-17-10(15)11-6-8(13)12-7(2)9(14)16-3/h4,7H,1,5-6H2,2-3H3,(H,11,15)(H,12,13)/t7-/m0/s1 |
| InChIKey | BCKWCIGNPXWUGA-ZETCQYMHSA-N |
| XLogP | -0.42 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|