C11H17N3O4 — CID 154717709
methyl (2S)-2-[[2-[(2-cyano-2-methylpropanoyl)amino]acetyl]amino]propanoate (PubChem CID 154717709) has the molecular formula C11H17N3O4 and a molecular weight of 255.27 g/mol. Its IUPAC name is methyl (2S)-2-[[2-[(2-cyano-2-methylpropanoyl)amino]acetyl]amino]propanoate.
| Compound Name | methyl (2S)-2-[[2-[(2-cyano-2-methylpropanoyl)amino]acetyl]amino]propanoate |
|---|---|
| PubChem CID | 154717709 |
| Molecular Formula | C11H17N3O4 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | methyl (2S)-2-[[2-[(2-cyano-2-methylpropanoyl)amino]acetyl]amino]propanoate |
| SMILES | COC(=O)[C@H](C)NC(=O)CNC(=O)C(C)(C)C#N |
| InChI | InChI=1S/C11H17N3O4/c1-7(9(16)18-4)14-8(15)5-13-10(17)11(2,3)6-12/h7H,5H2,1-4H3,(H,13,17)(H,14,15)/t7-/m0/s1 |
| InChIKey | QZRPDCBRXZRBLL-ZETCQYMHSA-N |
| XLogP | -0.67 |
| TPSA | 108.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |