C11H20N2O — CID 64598100
2-cyano-N-(2,3-dimethylbutyl)-2-methylpropanamide (PubChem CID 64598100) has the molecular formula C11H20N2O and a molecular weight of 196.29 g/mol. Its IUPAC name is 2-cyano-N-(2,3-dimethylbutyl)-2-methylpropanamide.
| Compound Name | 2-cyano-N-(2,3-dimethylbutyl)-2-methylpropanamide |
|---|---|
| PubChem CID | 64598100 |
| Molecular Formula | C11H20N2O |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | 2-cyano-N-(2,3-dimethylbutyl)-2-methylpropanamide |
| SMILES | CC(C)C(C)CNC(=O)C(C)(C)C#N |
| InChI | InChI=1S/C11H20N2O/c1-8(2)9(3)6-13-10(14)11(4,5)7-12/h8-9H,6H2,1-5H3,(H,13,14) |
| InChIKey | PZJPXQZISDSTSU-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |