C10H17N3O5 — CID 134741415
methyl (2R)-2-[[2-[(2-acetamidoacetyl)amino]acetyl]amino]propanoate (PubChem CID 134741415) has the molecular formula C10H17N3O5 and a molecular weight of 259.26 g/mol. Its IUPAC name is methyl (2R)-2-[[2-[(2-acetamidoacetyl)amino]acetyl]amino]propanoate.
| Compound Name | methyl (2R)-2-[[2-[(2-acetamidoacetyl)amino]acetyl]amino]propanoate |
|---|---|
| PubChem CID | 134741415 |
| Molecular Formula | C10H17N3O5 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | methyl (2R)-2-[[2-[(2-acetamidoacetyl)amino]acetyl]amino]propanoate |
| SMILES | COC(=O)[C@@H](C)NC(=O)CNC(=O)CNC(C)=O |
| InChI | InChI=1S/C10H17N3O5/c1-6(10(17)18-3)13-9(16)5-12-8(15)4-11-7(2)14/h6H,4-5H2,1-3H3,(H,11,14)(H,12,15)(H,13,16)/t6-/m1/s1 |
| InChIKey | JLSJNENSAQOMOY-ZCFIWIBFSA-N |
| XLogP | -2.08 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |