C7H11ClN2O3 — CID 167508048
prop-2-enyl N-[2-(chloromethylamino)-2-oxoethyl]carbamate (PubChem CID 167508048) has the molecular formula C7H11ClN2O3 and a molecular weight of 206.63 g/mol. Its IUPAC name is prop-2-enyl N-[2-(chloromethylamino)-2-oxoethyl]carbamate.
| Compound Name | prop-2-enyl N-[2-(chloromethylamino)-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 167508048 |
| Molecular Formula | C7H11ClN2O3 |
| Molecular Weight | 206.63 g/mol |
| Exact Mass | 206.05 |
| IUPAC Name | prop-2-enyl N-[2-(chloromethylamino)-2-oxoethyl]carbamate |
| SMILES | C=CCOC(=O)NCC(=O)NCCl |
| InChI | InChI=1S/C7H11ClN2O3/c1-2-3-13-7(12)9-4-6(11)10-5-8/h2H,1,3-5H2,(H,9,12)(H,10,11) |
| InChIKey | RMHYZPNYPNEERB-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.63 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|