C12H11Cl2NO3 — CID 121405265
prop-2-enyl N-[2-(3,4-dichlorophenyl)-2-oxoethyl]carbamate (PubChem CID 121405265) has the molecular formula C12H11Cl2NO3 and a molecular weight of 288.13 g/mol. Its IUPAC name is prop-2-enyl N-[2-(3,4-dichlorophenyl)-2-oxoethyl]carbamate.
| Compound Name | prop-2-enyl N-[2-(3,4-dichlorophenyl)-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 121405265 |
| Molecular Formula | C12H11Cl2NO3 |
| Molecular Weight | 288.13 g/mol |
| Exact Mass | 287.01 |
| IUPAC Name | prop-2-enyl N-[2-(3,4-dichlorophenyl)-2-oxoethyl]carbamate |
| SMILES | C=CCOC(=O)NCC(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H11Cl2NO3/c1-2-5-18-12(17)15-7-11(16)8-3-4-9(13)10(14)6-8/h2-4,6H,1,5,7H2,(H,15,17) |
| InChIKey | LVJGNZNBQJYDHJ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.13 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|