C13H18O6 — CID 101333550
trimethyl (2S,3Z)-2-methylhexa-3,5-diene-1,1,3-tricarboxylate (PubChem CID 101333550) has the molecular formula C13H18O6 and a molecular weight of 270.28 g/mol. Its IUPAC name is trimethyl (2S,3Z)-2-methylhexa-3,5-diene-1,1,3-tricarboxylate.
| Compound Name | trimethyl (2S,3Z)-2-methylhexa-3,5-diene-1,1,3-tricarboxylate |
|---|---|
| PubChem CID | 101333550 |
| Molecular Formula | C13H18O6 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | trimethyl (2S,3Z)-2-methylhexa-3,5-diene-1,1,3-tricarboxylate |
| SMILES | C=C/C=C(\C(=O)OC)[C@@H](C)C(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C13H18O6/c1-6-7-9(11(14)17-3)8(2)10(12(15)18-4)13(16)19-5/h6-8,10H,1H2,2-5H3/b9-7-/t8-/m1/s1 |
| InChIKey | PXIBHHJRVKAQBE-XZZQCUQZSA-N |
| XLogP | 0.87 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|