C12H18O6 — CID 132566153
trimethyl (2S)-2-methylpent-4-ene-1,1,3-tricarboxylate (PubChem CID 132566153) has the molecular formula C12H18O6 and a molecular weight of 258.27 g/mol. Its IUPAC name is trimethyl (2S)-2-methylpent-4-ene-1,1,3-tricarboxylate.
| Compound Name | trimethyl (2S)-2-methylpent-4-ene-1,1,3-tricarboxylate |
|---|---|
| PubChem CID | 132566153 |
| Molecular Formula | C12H18O6 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | trimethyl (2S)-2-methylpent-4-ene-1,1,3-tricarboxylate |
| SMILES | C=CC(C(=O)OC)[C@H](C)C(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C12H18O6/c1-6-8(10(13)16-3)7(2)9(11(14)17-4)12(15)18-5/h6-9H,1H2,2-5H3/t7-,8?/m0/s1 |
| InChIKey | NZZDGLLPNGKGNV-JAMMHHFISA-N |
| XLogP | 0.56 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|