C12H18O4 — CID 22986731
dimethyl 2-[(4E)-4-methylhexa-1,4-dien-3-yl]propanedioate (PubChem CID 22986731) has the molecular formula C12H18O4 and a molecular weight of 226.27 g/mol. Its IUPAC name is dimethyl 2-[(4E)-4-methylhexa-1,4-dien-3-yl]propanedioate.
| Compound Name | dimethyl 2-[(4E)-4-methylhexa-1,4-dien-3-yl]propanedioate |
|---|---|
| PubChem CID | 22986731 |
| Molecular Formula | C12H18O4 |
| Molecular Weight | 226.27 g/mol |
| Exact Mass | 226.12 |
| IUPAC Name | dimethyl 2-[(4E)-4-methylhexa-1,4-dien-3-yl]propanedioate |
| SMILES | C=CC(/C(C)=C/C)C(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C12H18O4/c1-6-8(3)9(7-2)10(11(13)15-4)12(14)16-5/h6-7,9-10H,2H2,1,3-5H3/b8-6+ |
| InChIKey | XQWWOVQKNIIBOB-SOFGYWHQSA-N |
| XLogP | 1.72 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.27 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|