C12H18O8 — CID 2192496
tetramethyl 2-methylpropane-1,1,3,3-tetracarboxylate (PubChem CID 2192496) has the molecular formula C12H18O8 and a molecular weight of 290.27 g/mol. Its IUPAC name is tetramethyl 2-methylpropane-1,1,3,3-tetracarboxylate.
| Compound Name | tetramethyl 2-methylpropane-1,1,3,3-tetracarboxylate |
|---|---|
| PubChem CID | 2192496 |
| Molecular Formula | C12H18O8 |
| Molecular Weight | 290.27 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | tetramethyl 2-methylpropane-1,1,3,3-tetracarboxylate |
| SMILES | COC(=O)C(C(=O)OC)C(C)C(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C12H18O8/c1-6(7(9(13)17-2)10(14)18-3)8(11(15)19-4)12(16)20-5/h6-8H,1-5H3 |
| InChIKey | HBESQLIEUULRDL-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.27 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|