C10H13N3O — CID 169189998
(3E,5Z,7Z)-5,8-diamino-3-[(methylideneamino)methylidene]octa-1,5,7-trien-4-one (PubChem CID 169189998) has the molecular formula C10H13N3O and a molecular weight of 191.23 g/mol. Its IUPAC name is (3E,5Z,7Z)-5,8-diamino-3-[(methylideneamino)methylidene]octa-1,5,7-trien-4-one.
| Compound Name | (3E,5Z,7Z)-5,8-diamino-3-[(methylideneamino)methylidene]octa-1,5,7-trien-4-one |
|---|---|
| PubChem CID | 169189998 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | (3E,5Z,7Z)-5,8-diamino-3-[(methylideneamino)methylidene]octa-1,5,7-trien-4-one |
| SMILES | C=C/C(=C\N=C)C(=O)/C(N)=C/C=C\N |
| InChI | InChI=1S/C10H13N3O/c1-3-8(7-13-2)10(14)9(12)5-4-6-11/h3-7H,1-2,11-12H2/b6-4-,8-7+,9-5- |
| InChIKey | GEESFOZTZSGQHE-ZYORNSTCSA-N |
| XLogP | 0.64 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|