C7H11ClN4S — CID 144541719
(2Z,4Z)-2,5-diamino-N'-(chloromethylsulfanyl)-N-methylidenepenta-2,4-dienimidamide (PubChem CID 144541719) has the molecular formula C7H11ClN4S and a molecular weight of 218.71 g/mol. Its IUPAC name is (2Z,4Z)-2,5-diamino-N'-(chloromethylsulfanyl)-N-methylidenepenta-2,4-dienimidamide.
| Compound Name | (2Z,4Z)-2,5-diamino-N'-(chloromethylsulfanyl)-N-methylidenepenta-2,4-dienimidamide |
|---|---|
| PubChem CID | 144541719 |
| Molecular Formula | C7H11ClN4S |
| Molecular Weight | 218.71 g/mol |
| Exact Mass | 218.04 |
| IUPAC Name | (2Z,4Z)-2,5-diamino-N'-(chloromethylsulfanyl)-N-methylidenepenta-2,4-dienimidamide |
| SMILES | C=NC(=N\SCCl)/C(N)=C/C=C\N |
| InChI | InChI=1S/C7H11ClN4S/c1-11-7(12-13-5-8)6(10)3-2-4-9/h2-4H,1,5,9-10H2/b4-2-,6-3-,12-7- |
| InChIKey | XKLITPSSHRXDPM-SGVPHJFASA-N |
| XLogP | 1.25 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.71 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|