C11H18FN3O — CID 167093310
4-[(2Z,4Z)-2,5-diaminopenta-2,4-dienyl]-4-fluoropiperidine-1-carbaldehyde (PubChem CID 167093310) has the molecular formula C11H18FN3O and a molecular weight of 227.28 g/mol. Its IUPAC name is 4-[(2Z,4Z)-2,5-diaminopenta-2,4-dienyl]-4-fluoropiperidine-1-carbaldehyde.
| Compound Name | 4-[(2Z,4Z)-2,5-diaminopenta-2,4-dienyl]-4-fluoropiperidine-1-carbaldehyde |
|---|---|
| PubChem CID | 167093310 |
| Molecular Formula | C11H18FN3O |
| Molecular Weight | 227.28 g/mol |
| Exact Mass | 227.14 |
| IUPAC Name | 4-[(2Z,4Z)-2,5-diaminopenta-2,4-dienyl]-4-fluoropiperidine-1-carbaldehyde |
| SMILES | N/C=C\C=C(/N)CC1(F)CCN(C=O)CC1 |
| InChI | InChI=1S/C11H18FN3O/c12-11(8-10(14)2-1-5-13)3-6-15(9-16)7-4-11/h1-2,5,9H,3-4,6-8,13-14H2/b5-1-,10-2- |
| InChIKey | YAQGYZOWKOFZDF-KHAVMBNRSA-N |
| XLogP | 0.65 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.28 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|