C9H16N2O2 — CID 153392281
(E,2E)-3-amino-2-[(methylideneamino)methylidene]pent-3-enal;methoxymethane (PubChem CID 153392281) has the molecular formula C9H16N2O2 and a molecular weight of 184.24 g/mol. Its IUPAC name is (E,2E)-3-amino-2-[(methylideneamino)methylidene]pent-3-enal;methoxymethane.
| Compound Name | (E,2E)-3-amino-2-[(methylideneamino)methylidene]pent-3-enal;methoxymethane |
|---|---|
| PubChem CID | 153392281 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | (E,2E)-3-amino-2-[(methylideneamino)methylidene]pent-3-enal;methoxymethane |
| SMILES | C=N/C=C(C=O)\C(N)=C/C.COC |
| InChI | InChI=1S/C7H10N2O.C2H6O/c1-3-7(8)6(5-10)4-9-2;1-3-2/h3-5H,2,8H2,1H3;1-2H3/b6-4-,7-3+; |
| InChIKey | RTMIHPVVKPNXQQ-VIEOHVPFSA-N |
| XLogP | 0.89 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|