About 2-ethenylbut-2-enedioic acid
2-ethenylbut-2-enedioic acid (PubChem CID 54086749) has the molecular formula C6H6O4
and a molecular weight of 142.11 g/mol. Its IUPAC name is 2-ethenylbut-2-enedioic acid.
Molecular Properties
| Compound Name | 2-ethenylbut-2-enedioic acid |
| PubChem CID | 54086749 |
| Molecular Formula | C6H6O4 |
| Molecular Weight | 142.11 g/mol |
| Exact Mass | 142.03 |
| IUPAC Name | 2-ethenylbut-2-enedioic acid |
| SMILES | C=CC(=CC(=O)O)C(=O)O |
| InChI | InChI=1S/C6H6O4/c1-2-4(6(9)10)3-5(7)8/h2-3H,1H2,(H,7,8)(H,9,10) |
| InChIKey | MRAKLTZPBIBWFH-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.11 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-ethenylbut-2-enedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethenylbut-2-enedioic acid?
The IUPAC name of 2-ethenylbut-2-enedioic acid (CID 54086749) is 2-ethenylbut-2-enedioic acid.
What is the SMILES notation for 2-ethenylbut-2-enedioic acid?
The canonical SMILES for 2-ethenylbut-2-enedioic acid is C=CC(=CC(=O)O)C(=O)O.
What is the InChIKey of 2-ethenylbut-2-enedioic acid?
The InChIKey is MRAKLTZPBIBWFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6O4/c1-2-4(6(9)10)3-5(7)8/h2-3H,1H2,(H,7,8)(H,9,10).
What are the key properties of 2-ethenylbut-2-enedioic acid?
2-ethenylbut-2-enedioic acid has a molecular weight of 142.11 g/mol, XLogP of 0.27, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethenylbut-2-enedioic acid is sourced from PubChem (CID 54086749), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).