C8H14N2O — CID 144623229
ethane;(2Z)-2-(methylideneamino)penta-2,4-dienamide (PubChem CID 144623229) has the molecular formula C8H14N2O and a molecular weight of 154.21 g/mol. Its IUPAC name is ethane;(2Z)-2-(methylideneamino)penta-2,4-dienamide.
| Compound Name | ethane;(2Z)-2-(methylideneamino)penta-2,4-dienamide |
|---|---|
| PubChem CID | 144623229 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | ethane;(2Z)-2-(methylideneamino)penta-2,4-dienamide |
| SMILES | C=C/C=C(\N=C)C(N)=O.CC |
| InChI | InChI=1S/C6H8N2O.C2H6/c1-3-4-5(8-2)6(7)9;1-2/h3-4H,1-2H2,(H2,7,9);1-2H3/b5-4-; |
| InChIKey | AAKBSIOUGHUQCA-MKWAYWHRSA-N |
| XLogP | 1.27 |
| TPSA | 55.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|