C16H29N — CID 178046177
ethane;N-[(3E,5Z)-5-ethenylhepta-1,3,5-trien-4-yl]methanimine;2-methylpropane (PubChem CID 178046177) has the molecular formula C16H29N and a molecular weight of 235.41 g/mol. Its IUPAC name is ethane;N-[(3E,5Z)-5-ethenylhepta-1,3,5-trien-4-yl]methanimine;2-methylpropane.
| Compound Name | ethane;N-[(3E,5Z)-5-ethenylhepta-1,3,5-trien-4-yl]methanimine;2-methylpropane |
|---|---|
| PubChem CID | 178046177 |
| Molecular Formula | C16H29N |
| Molecular Weight | 235.41 g/mol |
| Exact Mass | 235.23 |
| IUPAC Name | ethane;N-[(3E,5Z)-5-ethenylhepta-1,3,5-trien-4-yl]methanimine;2-methylpropane |
| SMILES | C=C/C=C(N=C)\C(C=C)=C/C.CC.CC(C)C |
| InChI | InChI=1S/C10H13N.C4H10.C2H6/c1-5-8-10(11-4)9(6-2)7-3;1-4(2)3;1-2/h5-8H,1-2,4H2,3H3;4H,1-3H3;1-2H3/b9-7-,10-8+;; |
| InChIKey | VIGNPCGYWBEMNK-ZVZOOREZSA-N |
| XLogP | 5.58 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.41 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|