About ethane;(3E)-3-ethenyl-2-methylhexa-1,3,5-triene;2-methylprop-1-ene
ethane;(3E)-3-ethenyl-2-methylhexa-1,3,5-triene;2-methylprop-1-ene (PubChem CID 142058077) has the molecular formula C15H26
and a molecular weight of 206.37 g/mol. Its IUPAC name is ethane;(3E)-3-ethenyl-2-methylhexa-1,3,5-triene;2-methylprop-1-ene.
Molecular Properties
| Compound Name | ethane;(3E)-3-ethenyl-2-methylhexa-1,3,5-triene;2-methylprop-1-ene |
| PubChem CID | 142058077 |
| Molecular Formula | C15H26 |
| Molecular Weight | 206.37 g/mol |
| Exact Mass | 206.20 |
| IUPAC Name | ethane;(3E)-3-ethenyl-2-methylhexa-1,3,5-triene;2-methylprop-1-ene |
| SMILES | C=C(C)C.C=C/C=C(\C=C)C(=C)C.CC |
| InChI | InChI=1S/C9H12.C4H8.C2H6/c1-5-7-9(6-2)8(3)4;1-4(2)3;1-2/h5-7H,1-3H2,4H3;1H2,2-3H3;1-2H3/b9-7+;; |
| InChIKey | ACZOFGSKLLPQMB-OJYIHNBOSA-N |
| XLogP | 5.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 206.37 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;(3E)-3-ethenyl-2-methylhexa-1,3,5-triene;2-methylprop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(3E)-3-ethenyl-2-methylhexa-1,3,5-triene;2-methylprop-1-ene?
The IUPAC name of ethane;(3E)-3-ethenyl-2-methylhexa-1,3,5-triene;2-methylprop-1-ene (CID 142058077) is ethane;(3E)-3-ethenyl-2-methylhexa-1,3,5-triene;2-methylprop-1-ene.
What is the SMILES notation for ethane;(3E)-3-ethenyl-2-methylhexa-1,3,5-triene;2-methylprop-1-ene?
The canonical SMILES for ethane;(3E)-3-ethenyl-2-methylhexa-1,3,5-triene;2-methylprop-1-ene is C=C(C)C.C=C/C=C(\C=C)C(=C)C.CC.
What is the InChIKey of ethane;(3E)-3-ethenyl-2-methylhexa-1,3,5-triene;2-methylprop-1-ene?
The InChIKey is ACZOFGSKLLPQMB-OJYIHNBOSA-N. The full InChI is InChI=1S/C9H12.C4H8.C2H6/c1-5-7-9(6-2)8(3)4;1-4(2)3;1-2/h5-7H,1-3H2,4H3;1H2,2-3H3;1-2H3/b9-7+;;.
What are the key properties of ethane;(3E)-3-ethenyl-2-methylhexa-1,3,5-triene;2-methylprop-1-ene?
ethane;(3E)-3-ethenyl-2-methylhexa-1,3,5-triene;2-methylprop-1-ene has a molecular weight of 206.37 g/mol, XLogP of 5.47, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(3E)-3-ethenyl-2-methylhexa-1,3,5-triene;2-methylprop-1-ene is sourced from PubChem (CID 142058077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).