C16H26 — CID 145084026
(3E,5E)-5-methyl-4-(2-methylprop-1-enyl)hepta-1,3,5-triene;2-methylprop-1-ene (PubChem CID 145084026) has the molecular formula C16H26 and a molecular weight of 218.38 g/mol. Its IUPAC name is (3E,5E)-5-methyl-4-(2-methylprop-1-enyl)hepta-1,3,5-triene;2-methylprop-1-ene.
| Compound Name | (3E,5E)-5-methyl-4-(2-methylprop-1-enyl)hepta-1,3,5-triene;2-methylprop-1-ene |
|---|---|
| PubChem CID | 145084026 |
| Molecular Formula | C16H26 |
| Molecular Weight | 218.38 g/mol |
| Exact Mass | 218.20 |
| IUPAC Name | (3E,5E)-5-methyl-4-(2-methylprop-1-enyl)hepta-1,3,5-triene;2-methylprop-1-ene |
| SMILES | C=C(C)C.C=C/C=C(C=C(C)C)/C(C)=C/C |
| InChI | InChI=1S/C12H18.C4H8/c1-6-8-12(9-10(3)4)11(5)7-2;1-4(2)3/h6-9H,1H2,2-5H3;1H2,2-3H3/b11-7+,12-8+; |
| InChIKey | OHLBUDZZENJUEI-GCHDFIKQSA-N |
| XLogP | 5.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.38 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|