C10H18S — CID 144628766
ethane;(3E,5Z)-5-methylhepta-1,3,5-triene-4-thiol (PubChem CID 144628766) has the molecular formula C10H18S and a molecular weight of 170.32 g/mol. Its IUPAC name is ethane;(3E,5Z)-5-methylhepta-1,3,5-triene-4-thiol.
| Compound Name | ethane;(3E,5Z)-5-methylhepta-1,3,5-triene-4-thiol |
|---|---|
| PubChem CID | 144628766 |
| Molecular Formula | C10H18S |
| Molecular Weight | 170.32 g/mol |
| Exact Mass | 170.11 |
| IUPAC Name | ethane;(3E,5Z)-5-methylhepta-1,3,5-triene-4-thiol |
| SMILES | C=C/C=C(S)\C(C)=C/C.CC |
| InChI | InChI=1S/C8H12S.C2H6/c1-4-6-8(9)7(3)5-2;1-2/h4-6,9H,1H2,2-3H3;1-2H3/b7-5-,8-6+; |
| InChIKey | KRJIFGUJCDUORR-KHCQPJBVSA-N |
| XLogP | 3.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.32 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|