C10H20S — CID 144755251
ethane;(3E)-hexa-1,3,5-triene-3-thiol (PubChem CID 144755251) has the molecular formula C10H20S and a molecular weight of 172.34 g/mol. Its IUPAC name is ethane;(3E)-hexa-1,3,5-triene-3-thiol.
| Compound Name | ethane;(3E)-hexa-1,3,5-triene-3-thiol |
|---|---|
| PubChem CID | 144755251 |
| Molecular Formula | C10H20S |
| Molecular Weight | 172.34 g/mol |
| Exact Mass | 172.13 |
| IUPAC Name | ethane;(3E)-hexa-1,3,5-triene-3-thiol |
| SMILES | C=C/C=C(/S)C=C.CC.CC |
| InChI | InChI=1S/C6H8S.2C2H6/c1-3-5-6(7)4-2;2*1-2/h3-5,7H,1-2H2;2*1-2H3/b6-5+;; |
| InChIKey | JXIZJAQNAXAOOZ-TXOOBNKBSA-N |
| XLogP | 4.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.34 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|