C7H8OS — CID 142851404
(2E)-2-ethenylpenta-2,4-dienethioic S-acid (PubChem CID 142851404) has the molecular formula C7H8OS and a molecular weight of 140.21 g/mol. Its IUPAC name is (2E)-2-ethenylpenta-2,4-dienethioic S-acid.
| Compound Name | (2E)-2-ethenylpenta-2,4-dienethioic S-acid |
|---|---|
| PubChem CID | 142851404 |
| Molecular Formula | C7H8OS |
| Molecular Weight | 140.21 g/mol |
| Exact Mass | 140.03 |
| IUPAC Name | (2E)-2-ethenylpenta-2,4-dienethioic S-acid |
| SMILES | C=C/C=C(\C=C)C(=O)S |
| InChI | InChI=1S/C7H8OS/c1-3-5-6(4-2)7(8)9/h3-5H,1-2H2,(H,8,9)/b6-5+ |
| InChIKey | GKZUQNHJMAMOJF-AATRIKPKSA-N |
| XLogP | 1.74 |
| TPSA | 17.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.21 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|