C13H23NO — CID 143734508
ethane;(2E)-2-ethenyl-N-(2-methylpropyl)penta-2,4-dienamide (PubChem CID 143734508) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is ethane;(2E)-2-ethenyl-N-(2-methylpropyl)penta-2,4-dienamide.
| Compound Name | ethane;(2E)-2-ethenyl-N-(2-methylpropyl)penta-2,4-dienamide |
|---|---|
| PubChem CID | 143734508 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | ethane;(2E)-2-ethenyl-N-(2-methylpropyl)penta-2,4-dienamide |
| SMILES | C=C/C=C(\C=C)C(=O)NCC(C)C.CC |
| InChI | InChI=1S/C11H17NO.C2H6/c1-5-7-10(6-2)11(13)12-8-9(3)4;1-2/h5-7,9H,1-2,8H2,3-4H3,(H,12,13);1-2H3/b10-7+; |
| InChIKey | AAMNLMZPSKGQAO-HCUGZAAXSA-N |
| XLogP | 3.08 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|