C24H30N2O2S — CID 169183043
ethane;(2E)-2-ethenyl-N-ethylpenta-2,4-dienamide;N-(2-phenylsulfanylphenyl)formamide (PubChem CID 169183043) has the molecular formula C24H30N2O2S and a molecular weight of 410.58 g/mol. Its IUPAC name is ethane;(2E)-2-ethenyl-N-ethylpenta-2,4-dienamide;N-(2-phenylsulfanylphenyl)formamide.
| Compound Name | ethane;(2E)-2-ethenyl-N-ethylpenta-2,4-dienamide;N-(2-phenylsulfanylphenyl)formamide |
|---|---|
| PubChem CID | 169183043 |
| Molecular Formula | C24H30N2O2S |
| Molecular Weight | 410.58 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | ethane;(2E)-2-ethenyl-N-ethylpenta-2,4-dienamide;N-(2-phenylsulfanylphenyl)formamide |
| SMILES | C=C/C=C(\C=C)C(=O)NCC.CC.O=CNc1ccccc1Sc1ccccc1 |
| InChI | InChI=1S/C13H11NOS.C9H13NO.C2H6/c15-10-14-12-8-4-5-9-13(12)16-11-6-2-1-3-7-11;1-4-7-8(5-2)9(11)10-6-3;1-2/h1-10H,(H,14,15);4-5,7H,1-2,6H2,3H3,(H,10,11);1-2H3/b;8-7+; |
| InChIKey | BIASSEUEOOHZIF-BVUSFOFSSA-N |
| XLogP | 5.85 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.58 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|