C9H15NO3 — CID 123533018
N-(2-methylpropyl)-2,4-dioxopentanamide (PubChem CID 123533018) has the molecular formula C9H15NO3 and a molecular weight of 185.22 g/mol. Its IUPAC name is N-(2-methylpropyl)-2,4-dioxopentanamide.
| Compound Name | N-(2-methylpropyl)-2,4-dioxopentanamide |
|---|---|
| PubChem CID | 123533018 |
| Molecular Formula | C9H15NO3 |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.11 |
| IUPAC Name | N-(2-methylpropyl)-2,4-dioxopentanamide |
| SMILES | CC(=O)CC(=O)C(=O)NCC(C)C |
| InChI | InChI=1S/C9H15NO3/c1-6(2)5-10-9(13)8(12)4-7(3)11/h6H,4-5H2,1-3H3,(H,10,13) |
| InChIKey | JJQGNYPVDGMTAA-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|