C14H24N2O2 — CID 90878864
N-tert-butyl-2,3-dimethylidene-N'-(2-methylpropyl)butanediamide (PubChem CID 90878864) has the molecular formula C14H24N2O2 and a molecular weight of 252.36 g/mol. Its IUPAC name is N-tert-butyl-2,3-dimethylidene-N'-(2-methylpropyl)butanediamide.
| Compound Name | N-tert-butyl-2,3-dimethylidene-N'-(2-methylpropyl)butanediamide |
|---|---|
| PubChem CID | 90878864 |
| Molecular Formula | C14H24N2O2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | N-tert-butyl-2,3-dimethylidene-N'-(2-methylpropyl)butanediamide |
| SMILES | C=C(C(=C)C(=O)NC(C)(C)C)C(=O)NCC(C)C |
| InChI | InChI=1S/C14H24N2O2/c1-9(2)8-15-12(17)10(3)11(4)13(18)16-14(5,6)7/h9H,3-4,8H2,1-2,5-7H3,(H,15,17)(H,16,18) |
| InChIKey | DHSVEABLQMOKNF-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|