C6H14N4O — CID 18722015
1-(diaminomethylidene)-3-(2-methylpropyl)urea (PubChem CID 18722015) has the molecular formula C6H14N4O and a molecular weight of 158.20 g/mol. Its IUPAC name is 1-(diaminomethylidene)-3-(2-methylpropyl)urea.
| Compound Name | 1-(diaminomethylidene)-3-(2-methylpropyl)urea |
|---|---|
| PubChem CID | 18722015 |
| Molecular Formula | C6H14N4O |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.12 |
| IUPAC Name | 1-(diaminomethylidene)-3-(2-methylpropyl)urea |
| SMILES | CC(C)CNC(=O)N=C(N)N |
| InChI | InChI=1S/C6H14N4O/c1-4(2)3-9-6(11)10-5(7)8/h4H,3H2,1-2H3,(H5,7,8,9,10,11) |
| InChIKey | JRLYQNHBBKZOLV-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|