C10H17NO4 — CID 166744253
methyl 5-(2-methylpropylamino)-4,5-dioxopentanoate (PubChem CID 166744253) has the molecular formula C10H17NO4 and a molecular weight of 215.25 g/mol. Its IUPAC name is methyl 5-(2-methylpropylamino)-4,5-dioxopentanoate.
| Compound Name | methyl 5-(2-methylpropylamino)-4,5-dioxopentanoate |
|---|---|
| PubChem CID | 166744253 |
| Molecular Formula | C10H17NO4 |
| Molecular Weight | 215.25 g/mol |
| Exact Mass | 215.12 |
| IUPAC Name | methyl 5-(2-methylpropylamino)-4,5-dioxopentanoate |
| SMILES | COC(=O)CCC(=O)C(=O)NCC(C)C |
| InChI | InChI=1S/C10H17NO4/c1-7(2)6-11-10(14)8(12)4-5-9(13)15-3/h7H,4-6H2,1-3H3,(H,11,14) |
| InChIKey | DREVSFSGUBIUSO-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.25 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|