C11H22N2O5S — CID 112691943
methyl 4-[[2-(2-methylpropylamino)-2-oxoethyl]sulfamoyl]butanoate (PubChem CID 112691943) has the molecular formula C11H22N2O5S and a molecular weight of 294.37 g/mol. Its IUPAC name is methyl 4-[[2-(2-methylpropylamino)-2-oxoethyl]sulfamoyl]butanoate.
| Compound Name | methyl 4-[[2-(2-methylpropylamino)-2-oxoethyl]sulfamoyl]butanoate |
|---|---|
| PubChem CID | 112691943 |
| Molecular Formula | C11H22N2O5S |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | methyl 4-[[2-(2-methylpropylamino)-2-oxoethyl]sulfamoyl]butanoate |
| SMILES | COC(=O)CCCS(=O)(=O)NCC(=O)NCC(C)C |
| InChI | InChI=1S/C11H22N2O5S/c1-9(2)7-12-10(14)8-13-19(16,17)6-4-5-11(15)18-3/h9,13H,4-8H2,1-3H3,(H,12,14) |
| InChIKey | RPKCMAKUZQIGES-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |