About prop-2-enoic acid;sulfanol
prop-2-enoic acid;sulfanol (PubChem CID 159751366) has the molecular formula C3H6O3S
and a molecular weight of 122.14 g/mol. Its IUPAC name is prop-2-enoic acid;sulfanol.
Molecular Properties
| Compound Name | prop-2-enoic acid;sulfanol |
| PubChem CID | 159751366 |
| Molecular Formula | C3H6O3S |
| Molecular Weight | 122.14 g/mol |
| Exact Mass | 122.00 |
| IUPAC Name | prop-2-enoic acid;sulfanol |
| SMILES | C=CC(=O)O.OS |
| InChI | InChI=1S/C3H4O2.H2OS/c1-2-3(4)5;1-2/h2H,1H2,(H,4,5);1-2H |
| InChIKey | NDRQNSICTXMXML-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.14 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enoic acid;sulfanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enoic acid;sulfanol?
The IUPAC name of prop-2-enoic acid;sulfanol (CID 159751366) is prop-2-enoic acid;sulfanol.
What is the SMILES notation for prop-2-enoic acid;sulfanol?
The canonical SMILES for prop-2-enoic acid;sulfanol is C=CC(=O)O.OS.
What is the InChIKey of prop-2-enoic acid;sulfanol?
The InChIKey is NDRQNSICTXMXML-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4O2.H2OS/c1-2-3(4)5;1-2/h2H,1H2,(H,4,5);1-2H.
What are the key properties of prop-2-enoic acid;sulfanol?
prop-2-enoic acid;sulfanol has a molecular weight of 122.14 g/mol, XLogP of 0.65, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enoic acid;sulfanol is sourced from PubChem (CID 159751366), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).