C7H10OS — CID 143508047
(2Z,4E)-4-sulfanylhepta-2,4,6-trien-1-ol (PubChem CID 143508047) has the molecular formula C7H10OS and a molecular weight of 142.22 g/mol. Its IUPAC name is (2Z,4E)-4-sulfanylhepta-2,4,6-trien-1-ol.
| Compound Name | (2Z,4E)-4-sulfanylhepta-2,4,6-trien-1-ol |
|---|---|
| PubChem CID | 143508047 |
| Molecular Formula | C7H10OS |
| Molecular Weight | 142.22 g/mol |
| Exact Mass | 142.05 |
| IUPAC Name | (2Z,4E)-4-sulfanylhepta-2,4,6-trien-1-ol |
| SMILES | C=C/C=C(S)\C=C/CO |
| InChI | InChI=1S/C7H10OS/c1-2-4-7(9)5-3-6-8/h2-5,8-9H,1,6H2/b5-3-,7-4+ |
| InChIKey | SRIUCMDMQWJCJI-XKSOLRDRSA-N |
| XLogP | 1.53 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.22 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|