C12H24O — CID 144981154
ethane;(2E)-2-prop-1-en-2-ylpenta-2,4-dien-1-ol (PubChem CID 144981154) has the molecular formula C12H24O and a molecular weight of 184.32 g/mol. Its IUPAC name is ethane;(2E)-2-prop-1-en-2-ylpenta-2,4-dien-1-ol.
| Compound Name | ethane;(2E)-2-prop-1-en-2-ylpenta-2,4-dien-1-ol |
|---|---|
| PubChem CID | 144981154 |
| Molecular Formula | C12H24O |
| Molecular Weight | 184.32 g/mol |
| Exact Mass | 184.18 |
| IUPAC Name | ethane;(2E)-2-prop-1-en-2-ylpenta-2,4-dien-1-ol |
| SMILES | C=C/C=C(/CO)C(=C)C.CC.CC |
| InChI | InChI=1S/C8H12O.2C2H6/c1-4-5-8(6-9)7(2)3;2*1-2/h4-5,9H,1-2,6H2,3H3;2*1-2H3/b8-5-;; |
| InChIKey | PMLPYQBFDKJWQN-XTKZWJJBSA-N |
| XLogP | 3.72 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.32 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|