C8H12FN — CID 143114210
(2Z)-2-(1-fluoroethenyl)-N-methylpenta-2,4-dien-1-amine (PubChem CID 143114210) has the molecular formula C8H12FN and a molecular weight of 141.19 g/mol. Its IUPAC name is (2Z)-2-(1-fluoroethenyl)-N-methylpenta-2,4-dien-1-amine.
| Compound Name | (2Z)-2-(1-fluoroethenyl)-N-methylpenta-2,4-dien-1-amine |
|---|---|
| PubChem CID | 143114210 |
| Molecular Formula | C8H12FN |
| Molecular Weight | 141.19 g/mol |
| Exact Mass | 141.10 |
| IUPAC Name | (2Z)-2-(1-fluoroethenyl)-N-methylpenta-2,4-dien-1-amine |
| SMILES | C=C/C=C(/CNC)C(=C)F |
| InChI | InChI=1S/C8H12FN/c1-4-5-8(6-10-3)7(2)9/h4-5,10H,1-2,6H2,3H3/b8-5- |
| InChIKey | XLQARVMSIZXBJU-YVMONPNESA-N |
| XLogP | 1.80 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.19 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|