C7H11NS2 — CID 143785892
(3Z)-3-[(sulfanylamino)methyl]hexa-1,3,5-triene-2-thiol (PubChem CID 143785892) has the molecular formula C7H11NS2 and a molecular weight of 173.31 g/mol. Its IUPAC name is (3Z)-3-[(sulfanylamino)methyl]hexa-1,3,5-triene-2-thiol.
| Compound Name | (3Z)-3-[(sulfanylamino)methyl]hexa-1,3,5-triene-2-thiol |
|---|---|
| PubChem CID | 143785892 |
| Molecular Formula | C7H11NS2 |
| Molecular Weight | 173.31 g/mol |
| Exact Mass | 173.03 |
| IUPAC Name | (3Z)-3-[(sulfanylamino)methyl]hexa-1,3,5-triene-2-thiol |
| SMILES | C=C/C=C(/CNS)C(=C)S |
| InChI | InChI=1S/C7H11NS2/c1-3-4-7(5-8-10)6(2)9/h3-4,8-10H,1-2,5H2/b7-4- |
| InChIKey | XQNBXKZACQUYOJ-DAXSKMNVSA-N |
| XLogP | 1.98 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.31 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|