C13H21BrO — CID 143510636
(3E,5E)-4-(bromomethyl)-5-(1-methoxyethenyl)hepta-1,3,5-triene;ethane (PubChem CID 143510636) has the molecular formula C13H21BrO and a molecular weight of 273.21 g/mol. Its IUPAC name is (3E,5E)-4-(bromomethyl)-5-(1-methoxyethenyl)hepta-1,3,5-triene;ethane.
| Compound Name | (3E,5E)-4-(bromomethyl)-5-(1-methoxyethenyl)hepta-1,3,5-triene;ethane |
|---|---|
| PubChem CID | 143510636 |
| Molecular Formula | C13H21BrO |
| Molecular Weight | 273.21 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | (3E,5E)-4-(bromomethyl)-5-(1-methoxyethenyl)hepta-1,3,5-triene;ethane |
| SMILES | C=C/C=C(CBr)\C(=C/C)C(=C)OC.CC |
| InChI | InChI=1S/C11H15BrO.C2H6/c1-5-7-10(8-12)11(6-2)9(3)13-4;1-2/h5-7H,1,3,8H2,2,4H3;1-2H3/b10-7-,11-6-; |
| InChIKey | YPATYZAOWLMBAB-OSDHDUCRSA-N |
| XLogP | 4.63 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.21 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|