C8H15BrO — CID 166167224
(3E)-3-bromo-2-methoxypenta-1,3-diene;ethane (PubChem CID 166167224) has the molecular formula C8H15BrO and a molecular weight of 207.11 g/mol. Its IUPAC name is (3E)-3-bromo-2-methoxypenta-1,3-diene;ethane.
| Compound Name | (3E)-3-bromo-2-methoxypenta-1,3-diene;ethane |
|---|---|
| PubChem CID | 166167224 |
| Molecular Formula | C8H15BrO |
| Molecular Weight | 207.11 g/mol |
| Exact Mass | 206.03 |
| IUPAC Name | (3E)-3-bromo-2-methoxypenta-1,3-diene;ethane |
| SMILES | C=C(OC)/C(Br)=C\C.CC |
| InChI | InChI=1S/C6H9BrO.C2H6/c1-4-6(7)5(2)8-3;1-2/h4H,2H2,1,3H3;1-2H3/b6-4+; |
| InChIKey | GSNFOGHDBOFOSF-CVDVRWGVSA-N |
| XLogP | 3.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.11 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|