C10H13Br — CID 156799565
(4E,5E)-5-bromo-4-ethylidene-3-methylidenehepta-1,5-diene (PubChem CID 156799565) has the molecular formula C10H13Br and a molecular weight of 213.12 g/mol. Its IUPAC name is (4E,5E)-5-bromo-4-ethylidene-3-methylidenehepta-1,5-diene.
| Compound Name | (4E,5E)-5-bromo-4-ethylidene-3-methylidenehepta-1,5-diene |
|---|---|
| PubChem CID | 156799565 |
| Molecular Formula | C10H13Br |
| Molecular Weight | 213.12 g/mol |
| Exact Mass | 212.02 |
| IUPAC Name | (4E,5E)-5-bromo-4-ethylidene-3-methylidenehepta-1,5-diene |
| SMILES | C=CC(=C)C(=CC)/C(Br)=C\C |
| InChI | InChI=1S/C10H13Br/c1-5-8(4)9(6-2)10(11)7-3/h5-7H,1,4H2,2-3H3/b9-6+,10-7+ |
| InChIKey | FNPRAGGIWZZLAZ-KZZDLZNXSA-N |
| XLogP | 3.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.12 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|