About N-[(3E)-3-bromopenta-1,3-dien-2-yl]oxymethanamine
N-[(3E)-3-bromopenta-1,3-dien-2-yl]oxymethanamine (PubChem CID 139576198) has the molecular formula C6H10BrNO
and a molecular weight of 192.06 g/mol. Its IUPAC name is N-[(3E)-3-bromopenta-1,3-dien-2-yl]oxymethanamine.
Molecular Properties
| Compound Name | N-[(3E)-3-bromopenta-1,3-dien-2-yl]oxymethanamine |
| PubChem CID | 139576198 |
| Molecular Formula | C6H10BrNO |
| Molecular Weight | 192.06 g/mol |
| Exact Mass | 190.99 |
| IUPAC Name | N-[(3E)-3-bromopenta-1,3-dien-2-yl]oxymethanamine |
| SMILES | C=C(ONC)/C(Br)=C\C |
| InChI | InChI=1S/C6H10BrNO/c1-4-6(7)5(2)9-8-3/h4,8H,2H2,1,3H3/b6-4+ |
| InChIKey | LZFFAYFYYHTRTG-GQCTYLIASA-N |
| XLogP | 1.95 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.06 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(3E)-3-bromopenta-1,3-dien-2-yl]oxymethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3E)-3-bromopenta-1,3-dien-2-yl]oxymethanamine?
The IUPAC name of N-[(3E)-3-bromopenta-1,3-dien-2-yl]oxymethanamine (CID 139576198) is N-[(3E)-3-bromopenta-1,3-dien-2-yl]oxymethanamine.
What is the SMILES notation for N-[(3E)-3-bromopenta-1,3-dien-2-yl]oxymethanamine?
The canonical SMILES for N-[(3E)-3-bromopenta-1,3-dien-2-yl]oxymethanamine is C=C(ONC)/C(Br)=C\C.
What is the InChIKey of N-[(3E)-3-bromopenta-1,3-dien-2-yl]oxymethanamine?
The InChIKey is LZFFAYFYYHTRTG-GQCTYLIASA-N. The full InChI is InChI=1S/C6H10BrNO/c1-4-6(7)5(2)9-8-3/h4,8H,2H2,1,3H3/b6-4+.
What are the key properties of N-[(3E)-3-bromopenta-1,3-dien-2-yl]oxymethanamine?
N-[(3E)-3-bromopenta-1,3-dien-2-yl]oxymethanamine has a molecular weight of 192.06 g/mol, XLogP of 1.95, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3E)-3-bromopenta-1,3-dien-2-yl]oxymethanamine is sourced from PubChem (CID 139576198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).