C6H10BrNO — CID 139576198
N-[(3E)-3-bromopenta-1,3-dien-2-yl]oxymethanamine (PubChem CID 139576198) has the molecular formula C6H10BrNO and a molecular weight of 192.06 g/mol. Its IUPAC name is N-[(3E)-3-bromopenta-1,3-dien-2-yl]oxymethanamine.
| Compound Name | N-[(3E)-3-bromopenta-1,3-dien-2-yl]oxymethanamine |
|---|---|
| PubChem CID | 139576198 |
| Molecular Formula | C6H10BrNO |
| Molecular Weight | 192.06 g/mol |
| Exact Mass | 190.99 |
| IUPAC Name | N-[(3E)-3-bromopenta-1,3-dien-2-yl]oxymethanamine |
| SMILES | C=C(ONC)/C(Br)=C\C |
| InChI | InChI=1S/C6H10BrNO/c1-4-6(7)5(2)9-8-3/h4,8H,2H2,1,3H3/b6-4+ |
| InChIKey | LZFFAYFYYHTRTG-GQCTYLIASA-N |
| XLogP | 1.95 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.06 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|