C6H9BrO — CID 147749518
(3E)-2-bromo-3-methoxypenta-1,3-diene (PubChem CID 147749518) has the molecular formula C6H9BrO and a molecular weight of 177.04 g/mol. Its IUPAC name is (3E)-2-bromo-3-methoxypenta-1,3-diene.
| Compound Name | (3E)-2-bromo-3-methoxypenta-1,3-diene |
|---|---|
| PubChem CID | 147749518 |
| Molecular Formula | C6H9BrO |
| Molecular Weight | 177.04 g/mol |
| Exact Mass | 175.98 |
| IUPAC Name | (3E)-2-bromo-3-methoxypenta-1,3-diene |
| SMILES | C=C(Br)/C(=C\C)OC |
| InChI | InChI=1S/C6H9BrO/c1-4-6(8-3)5(2)7/h4H,2H2,1,3H3/b6-4+ |
| InChIKey | HBXUNQXTIWUXAD-GQCTYLIASA-N |
| XLogP | 2.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.04 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|