C7H12N2O — CID 166783383
[(3E)-3-methoxyhexa-1,3-dien-2-yl]diazene (PubChem CID 166783383) has the molecular formula C7H12N2O and a molecular weight of 140.19 g/mol. Its IUPAC name is [(3E)-3-methoxyhexa-1,3-dien-2-yl]diazene.
| Compound Name | [(3E)-3-methoxyhexa-1,3-dien-2-yl]diazene |
|---|---|
| PubChem CID | 166783383 |
| Molecular Formula | C7H12N2O |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.09 |
| IUPAC Name | [(3E)-3-methoxyhexa-1,3-dien-2-yl]diazene |
| SMILES | [H]/N=N/C(=C)/C(=C\CC)OC |
| InChI | InChI=1S/C7H12N2O/c1-4-5-7(10-3)6(2)9-8/h5,8H,2,4H2,1,3H3/b7-5+,9-8+ |
| InChIKey | FYODXVPAHLCMCP-ZIRGRKGMSA-N |
| XLogP | 2.47 |
| TPSA | 45.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|