C10H16O2 — CID 123258138
2,4-dimethoxy-5-methylidenehepta-1,3-diene (PubChem CID 123258138) has the molecular formula C10H16O2 and a molecular weight of 168.24 g/mol. Its IUPAC name is 2,4-dimethoxy-5-methylidenehepta-1,3-diene.
| Compound Name | 2,4-dimethoxy-5-methylidenehepta-1,3-diene |
|---|---|
| PubChem CID | 123258138 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | 2,4-dimethoxy-5-methylidenehepta-1,3-diene |
| SMILES | C=C(C=C(OC)C(=C)CC)OC |
| InChI | InChI=1S/C10H16O2/c1-6-8(2)10(12-5)7-9(3)11-4/h7H,2-3,6H2,1,4-5H3 |
| InChIKey | WNHLDNXNQSQTTQ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|