C11H21NO2 — CID 142423701
(3E)-3,5-dimethoxy-2-methylidenehexa-3,5-dien-1-amine;ethane (PubChem CID 142423701) has the molecular formula C11H21NO2 and a molecular weight of 199.29 g/mol. Its IUPAC name is (3E)-3,5-dimethoxy-2-methylidenehexa-3,5-dien-1-amine;ethane.
| Compound Name | (3E)-3,5-dimethoxy-2-methylidenehexa-3,5-dien-1-amine;ethane |
|---|---|
| PubChem CID | 142423701 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | (3E)-3,5-dimethoxy-2-methylidenehexa-3,5-dien-1-amine;ethane |
| SMILES | C=C(/C=C(/OC)C(=C)CN)OC.CC |
| InChI | InChI=1S/C9H15NO2.C2H6/c1-7(6-10)9(12-4)5-8(2)11-3;1-2/h5H,1-2,6,10H2,3-4H3;1-2H3/b9-5+; |
| InChIKey | UWTMNUYEVVXHRE-SZKNIZGXSA-N |
| XLogP | 2.22 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|